EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O3 |
| Net Charge | 0 |
| Average Mass | 220.268 |
| Monoisotopic Mass | 220.10994 |
| SMILES | CCOC(=O)C(CC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C13H16O3/c1-3-16-13(15)12(9-10(2)14)11-7-5-4-6-8-11/h4-8,12H,3,9H2,1-2H3 |
| InChIKey | MPTUXQOIIUTVGD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryctolagus cuniculus (ncbitaxon:9986) | longissimus thoracis (BTO:0001651) | MetaboLights (MTBLS8958) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ethyl 4-oxo-2-phenylpentanoate (CHEBI:229426) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| ethyl 4-oxo-2-phenylpentanoate |
| Manual Xrefs | Databases |
|---|---|
| 208338 | ChemSpider |