EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H31N |
| Net Charge | 0 |
| Average Mass | 213.409 |
| Monoisotopic Mass | 213.24565 |
| SMILES | CCCCCCCCCCCCN(C)C |
| InChI | InChI=1S/C14H31N/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3/h4-14H2,1-3H3 |
| InChIKey | YWFWDNVOPHGWMX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryctolagus cuniculus (ncbitaxon:9986) | longissimus thoracis (BTO:0001651) | MetaboLights (MTBLS8958) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dimethyl-1-Dodecanamine (CHEBI:229425) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N,N-dimethyldodecan-1-amine |
| Manual Xrefs | Databases |
|---|---|
| HMDB0255262 | HMDB |
| 7876 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:112-18-5 | ChemIDplus |