EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6N2O |
| Net Charge | 0 |
| Average Mass | 110.116 |
| Monoisotopic Mass | 110.04801 |
| SMILES | Nc1ccnc(=O)c1 |
| InChI | InChI=1S/C5H6N2O/c6-4-1-2-7-5(8)3-4/h1-3H,(H3,6,7,8) |
| InChIKey | SBQVQYPJWLJRQT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryctolagus cuniculus (ncbitaxon:9986) | longissimus thoracis (BTO:0001651) | MetaboLights (MTBLS8958) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Amino-2(1H)-pyridinone (CHEBI:229398) is a aminopyridine (CHEBI:38207) |
| IUPAC Name |
|---|
| 4-amino-1H-pyridin-2-one |
| Manual Xrefs | Databases |
|---|---|
| 498654 | ChemSpider |