EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20O4 |
| Net Charge | 0 |
| Average Mass | 216.277 |
| Monoisotopic Mass | 216.13616 |
| SMILES | CC(C)COC(=O)C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C11H20O4/c1-8(2)6-14-9(12)10(13)15-7-11(3,4)5/h8H,6-7H2,1-5H3 |
| InChIKey | YDBYGUVXKQJDOS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryctolagus cuniculus (ncbitaxon:9986) | longissimus thoracis (BTO:0001651) | MetaboLights (MTBLS8958) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Oxalic acid, isobutyl neopentyl ester (CHEBI:229370) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| 2-O-(2,2-dimethylpropyl) 1-O-(2-methylpropyl) oxalate |
| Manual Xrefs | Databases |
|---|---|
| 4926344 | ChemSpider |