EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H24O4 |
| Net Charge | 0 |
| Average Mass | 244.331 |
| Monoisotopic Mass | 244.16746 |
| SMILES | CCCCCCOC(=O)C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C13H24O4/c1-5-6-7-8-9-16-11(14)12(15)17-10-13(2,3)4/h5-10H2,1-4H3 |
| InChIKey | STGLIRNVFNSAED-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryctolagus cuniculus (ncbitaxon:9986) | longissimus thoracis (BTO:0001651) | MetaboLights (MTBLS8958) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Oxalic acid, hexyl neopentyl ester (CHEBI:229361) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| 2-O-(2,2-dimethylpropyl) 1-O-hexyl oxalate |
| Manual Xrefs | Databases |
|---|---|
| 4925949 | ChemSpider |