EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9ClO2 |
| Net Charge | 0 |
| Average Mass | 136.578 |
| Monoisotopic Mass | 136.02911 |
| SMILES | CC(C)[C@H](Cl)C(=O)O |
| InChI | InChI=1S/C5H9ClO2/c1-3(2)4(6)5(7)8/h3-4H,1-2H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | DDTJFSPKEIAZAM-BYPYZUCNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryctolagus cuniculus (ncbitaxon:9986) | longissimus thoracis (BTO:0001651) | MetaboLights (MTBLS8958) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2-Chloro-3-methylbutyric acid (CHEBI:229309) is a halo fatty acid (CHEBI:60692) |
| IUPAC Name |
|---|
| (2S)-2-chloro-3-methylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4482437 | ChemSpider |