EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13NO2 |
| Net Charge | 0 |
| Average Mass | 143.186 |
| Monoisotopic Mass | 143.09463 |
| SMILES | O=C(O)CNC1CCCC1 |
| InChI | InChI=1S/C7H13NO2/c9-7(10)5-8-6-3-1-2-4-6/h6,8H,1-5H2,(H,9,10) |
| InChIKey | LRHRHAWNXCGABU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryctolagus cuniculus (ncbitaxon:9986) | longissimus thoracis (BTO:0001651) | MetaboLights (MTBLS8957) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyclopentylglycine (CHEBI:229257) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-(cyclopentylamino)acetic acid |