EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6ClN |
| Net Charge | 0 |
| Average Mass | 127.574 |
| Monoisotopic Mass | 127.01888 |
| SMILES | Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C6H6ClN/c7-5-2-1-3-6(8)4-5/h1-4H,8H2 |
| InChIKey | PNPCRKVUWYDDST-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryctolagus cuniculus (ncbitaxon:9986) | longissimus thoracis (BTO:0001651) | MetaboLights (MTBLS8957) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Chloroaniline (CHEBI:229245) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 3-chloroaniline |
| Manual Xrefs | Databases |
|---|---|
| 13869451 | ChemSpider |
| HMDB0245839 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:108-42-9 | ChemIDplus |