EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26FNO5 |
| Net Charge | 0 |
| Average Mass | 427.472 |
| Monoisotopic Mass | 427.17950 |
| SMILES | OC[C@H]1O[C@@H](n2cc(Cc3ccc(C4CC4)cc3)c3c(F)cccc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H26FNO5/c25-17-2-1-3-18-20(17)16(10-13-4-6-14(7-5-13)15-8-9-15)11-26(18)24-23(30)22(29)21(28)19(12-27)31-24/h1-7,11,15,19,21-24,27-30H,8-10,12H2/t19-,21-,22+,23-,24-/m1/s1 |
| InChIKey | PXRGAWZIQZMHTH-PFKOEMKTSA-N |
| Roles Classification |
|---|
| Biological Role: | sodium-glucose transport protein subtype 2 inhibitor Any inhibitor that interferes with the action of sodium-glucose transport protein subtype 2. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TA-1887 (CHEBI:229237) has role hypoglycemic agent (CHEBI:35526) |
| TA-1887 (CHEBI:229237) has role sodium-glucose transport protein subtype 2 inhibitor (CHEBI:73273) |
| TA-1887 (CHEBI:229237) is a N-glycosyl compound (CHEBI:21731) |
| TA-1887 (CHEBI:229237) is a benzenes (CHEBI:22712) |
| TA-1887 (CHEBI:229237) is a cyclopropanes (CHEBI:51454) |
| TA-1887 (CHEBI:229237) is a fluoroindole (CHEBI:131960) |
| IUPAC Name |
|---|
| 3-(4-cyclopropylbenzyl)-4-fluoro-1-β-D-glucopyranosyl-1H-indole |
| Synonyms | Source |
|---|---|
| JNJ-39933673 | ChEBI |
| 3-[(4-cyclopropylphenyl)methyl]-4-fluoro-1-β-D-glucopyranosyl-1H-indole | IUPAC |
| (2R,3R,4S,5S,6R)-2-[3-(4-cyclopropylbenzyl)-4-fluoro-1H-indol-1-yl]-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol | IUPAC |
| (2R,3R,4S,5S,6R)-2-[3-[(4-cyclopropylphenyl)methyl]-4-fluoranyl-indol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol | ChEBI |
| JNJ39933673 | ChEBI |
| TA1887 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| KZ3 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:1003005-29-5 | ChEBI |
| Citations |
|---|