EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15FN6OS |
| Net Charge | 0 |
| Average Mass | 358.402 |
| Monoisotopic Mass | 358.10121 |
| SMILES | Cc1nsc(-c2nnc3n2CCN(C(=O)c2ccc(F)cc2)[C@@H]3C)n1 |
| InChI | InChI=1S/C16H15FN6OS/c1-9-13-19-20-14(15-18-10(2)21-25-15)23(13)8-7-22(9)16(24)11-3-5-12(17)6-4-11/h3-6,9H,7-8H2,1-2H3/t9-/m1/s1 |
| InChIKey | PPSNFPASKFYPMN-SECBINFHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | neurokinin-3 receptor antagonist An antagonist at the neurokinin-3 receptor. |
| Application: | renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fezolinetant (CHEBI:229236) has role neurokinin-3 receptor antagonist (CHEBI:140482) |
| fezolinetant (CHEBI:229236) has role renoprotective agent (CHEBI:231911) |
| fezolinetant (CHEBI:229236) is a benzamides (CHEBI:22702) |
| fezolinetant (CHEBI:229236) is a monofluorobenzenes (CHEBI:83575) |
| fezolinetant (CHEBI:229236) is a tertiary carboxamide (CHEBI:140326) |
| fezolinetant (CHEBI:229236) is a thiadiazoles (CHEBI:38099) |
| fezolinetant (CHEBI:229236) is a triazolopyrazine (CHEBI:48277) |
| IUPAC Name |
|---|
| (4-fluorophenyl)[(8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-5,6-dihydro[1,2,4]triazolo[4,3-a]pyrazin-7(8H)-yl]methanone |
| INNs | Source |
|---|---|
| fezolinetant | WHO MedNet |
| fezolinetant | WHO MedNet |
| fézolinétant | WHO MedNet |
| fezolinetantum | WHO MedNet |
| Synonyms | Source |
|---|---|
| A-2693 | ChEMBL |
| A2693 | ChEMBL |
| AS-3472693-00 | ChEMBL |
| AS3472693-00 | ChEMBL |
| ES-256364 | ChEMBL |
| ESN 364 | DrugBank |
| Brand Names | Source |
|---|---|
| Veoza | ChEMBL |
| Veozah | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D11976 | KEGG DRUG |
| DB15669 | DrugBank |
| Fezolinetant | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1629229-37-3 | KEGG DRUG |
| Citations |
|---|