EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H25F3NO3 |
| Net Charge | -1 |
| Average Mass | 456.484 |
| Monoisotopic Mass | 456.17920 |
| SMILES | O=C([O-])C[C@H]1CCc2c1nc1ccc(OCc3ccc(C4CCCC4)c(C(F)(F)F)c3)cc21 |
| InChI | InChI=1S/C26H26F3NO3/c27-26(28,29)22-11-15(5-8-19(22)16-3-1-2-4-16)14-33-18-7-10-23-21(13-18)20-9-6-17(12-24(31)32)25(20)30-23/h5,7-8,10-11,13,16-17,30H,1-4,6,9,12,14H2,(H,31,32)/p-1/t17-/m1/s1 |
| InChIKey | MVGWUTBTXDYMND-QGZVFWFLSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etrasimod(1−) (CHEBI:229232) is a monocarboxylic acid anion (CHEBI:35757) |
| etrasimod(1−) (CHEBI:229232) is conjugate base of etrasimod (CHEBI:229230) |
| Incoming Relation(s) |
| etrasimod arginine (CHEBI:229231) has part etrasimod(1−) (CHEBI:229232) |
| etrasimod (CHEBI:229230) is conjugate acid of etrasimod(1−) (CHEBI:229232) |
| IUPAC Name |
|---|
| [(3R)-7-{[4-cyclopentyl-3-(trifluoromethyl)benzyl]oxy}-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl]acetate |
| Synonyms | Source |
|---|---|
| APD334 anion | ChEBI |
| etrasimod anion | ChEBI |