EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25ClO5S |
| Net Charge | 0 |
| Average Mass | 424.946 |
| Monoisotopic Mass | 424.11112 |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](SC)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H25ClO5S/c1-3-26-15-7-4-12(5-8-15)10-14-11-13(6-9-16(14)22)20-18(24)17(23)19(25)21(27-20)28-2/h4-9,11,17-21,23-25H,3,10H2,1-2H3/t17-,18-,19+,20+,21-/m1/s1 |
| InChIKey | QKDRXGFQVGOQKS-CRSSMBPESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | sodium-glucose transport protein subtype 2 inhibitor Any inhibitor that interferes with the action of sodium-glucose transport protein subtype 2. sodium-glucose transport protein subtype 1 inhibitor Any inhibitor that interferes with the action of sodium-glucose transport protein subtype 1. |
| Applications: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. renoprotective agent Any compound that is able to prevent damage to the kidneys. hypoglycemic agent A drug which lowers the blood glucose level. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sotagliflozin (CHEBI:229226) has role antihypertensive agent (CHEBI:35674) |
| sotagliflozin (CHEBI:229226) has role cardioprotective agent (CHEBI:77307) |
| sotagliflozin (CHEBI:229226) has role cardiovascular drug (CHEBI:35554) |
| sotagliflozin (CHEBI:229226) has role hypoglycemic agent (CHEBI:35526) |
| sotagliflozin (CHEBI:229226) has role renoprotective agent (CHEBI:231911) |
| sotagliflozin (CHEBI:229226) has role sodium-glucose transport protein subtype 1 inhibitor (CHEBI:229227) |
| sotagliflozin (CHEBI:229226) has role sodium-glucose transport protein subtype 2 inhibitor (CHEBI:73273) |
| sotagliflozin (CHEBI:229226) is a C-glycosyl compound (CHEBI:20857) |
| sotagliflozin (CHEBI:229226) is a S-glycosyl compound (CHEBI:35275) |
| sotagliflozin (CHEBI:229226) is a aromatic ether (CHEBI:35618) |
| sotagliflozin (CHEBI:229226) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| methyl (5S)-5-[4-chloro-3-(4-ethoxybenzyl)phenyl]-1-thio-β-L-xylopyranoside |
| INNs | Source |
|---|---|
| sotagliflozin | WHO MedNet |
| sotagliflozina | WHO MedNet |
| sotagliflozine | WHO MedNet |
| sotagliflozinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (2S,3R,4R,5S,6R)-2-[4-chloro-3-(4-ethoxybenzyl)phenyl]-6-(methylsulfanyl)tetrahydro-2H-pyran-3,4,5-triol | IUPAC |
| (2S,3R,4R,5S,6R)-2-(4-chloro-3-(4-ethoxybenzyl)phenyl)- 6-(methylthio)tetrahydro-2H-pyran-3,4,5-triol | ChEBI |
| (2S,3R,4R,5S,6R)-2-{4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl}-6-(methylsulfanyl)oxane-3,4,5-triol | IUPAC |
| LP-802034 | DrugBank |
| LX 4211 | ChEBI |
| LX-4211 | ChEBI |
| Brand Names | Source |
|---|---|
| Inpefa | DrugBank |
| Zynquista | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D10669 | KEGG DRUG |
| DB12713 | DrugBank |
| HMDB0258396 | HMDB |
| LFL | PDBeChem |
| Sotagliflozin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1018899-04-1 | KEGG DRUG |
| Citations |
|---|