EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29ClO7 |
| Net Charge | 0 |
| Average Mass | 464.942 |
| Monoisotopic Mass | 464.16018 |
| SMILES | OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(OCCOC4CC4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H29ClO7/c25-19-8-3-15(24-23(29)22(28)21(27)20(13-26)32-24)12-16(19)11-14-1-4-17(5-2-14)30-9-10-31-18-6-7-18/h1-5,8,12,18,20-24,26-29H,6-7,9-11,13H2/t20-,21-,22+,23-,24+/m1/s1 |
| InChIKey | BTCRKOKVYTVOLU-SJSRKZJXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | sodium-glucose transport protein subtype 2 inhibitor Any inhibitor that interferes with the action of sodium-glucose transport protein subtype 2. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bexagliflozin (CHEBI:229225) has role antihypertensive agent (CHEBI:35674) |
| bexagliflozin (CHEBI:229225) has role hypoglycemic agent (CHEBI:35526) |
| bexagliflozin (CHEBI:229225) has role sodium-glucose transport protein subtype 2 inhibitor (CHEBI:73273) |
| bexagliflozin (CHEBI:229225) is a C-glycosyl compound (CHEBI:20857) |
| bexagliflozin (CHEBI:229225) is a aromatic ether (CHEBI:35618) |
| bexagliflozin (CHEBI:229225) is a cyclopropanes (CHEBI:51454) |
| bexagliflozin (CHEBI:229225) is a diether (CHEBI:46786) |
| bexagliflozin (CHEBI:229225) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-(4-chloro-3-{4-[2-(cyclopropyloxy)ethoxy]benzyl}phenyl)-D-glucitol |
| INNs | Source |
|---|---|
| bexagliflozina | WHO MedNet |
| bexagliflozinum | WHO MedNet |
| bexagliflozin | WHO MedNet |
| bexagliflozine | WHO MedNet |
| Synonyms | Source |
|---|---|
| EGT-1442 | DrugBank |
| THR1442 | DrugBank |
| EGT0001442 | DrugBank |
| THR-1442 | DrugBank |
| EGT1442 | DrugBank |
| THR 1442 | ChEBI |
| Brand Name | Source |
|---|---|
| Brenzavvy | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| DB12236 | DrugBank |
| D10865 | KEGG DRUG |
| Bexagliflozin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1118567-05-7 | KEGG DRUG |
| Citations |
|---|