EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25ClN6O2 |
| Net Charge | 0 |
| Average Mass | 428.924 |
| Monoisotopic Mass | 428.17275 |
| SMILES | NC1(C(=O)N[C@@H](CCO)c2ccc(Cl)cc2)CCN(c2ncnc3nccc23)CC1 |
| InChI | InChI=1S/C21H25ClN6O2/c22-15-3-1-14(2-4-15)17(6-12-29)27-20(30)21(23)7-10-28(11-8-21)19-16-5-9-24-18(16)25-13-26-19/h1-5,9,13,17,29H,6-8,10-12,23H2,(H,27,30)(H,24,25,26)/t17-/m0/s1 |
| InChIKey | JDUBGYFRJFOXQC-KRWDZBQOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| capivasertib (CHEBI:229222) has role antineoplastic agent (CHEBI:35610) |
| capivasertib (CHEBI:229222) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| capivasertib (CHEBI:229222) is a aminopiperidine (CHEBI:48588) |
| capivasertib (CHEBI:229222) is a monochlorobenzenes (CHEBI:83403) |
| capivasertib (CHEBI:229222) is a piperidinecarboxamide (CHEBI:48592) |
| capivasertib (CHEBI:229222) is a primary alcohol (CHEBI:15734) |
| capivasertib (CHEBI:229222) is a pyrrolopyrimidine (CHEBI:38670) |
| capivasertib (CHEBI:229222) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 4-amino-N-[(1S)-1-(4-chlorophenyl)-3-hydroxypropyl]-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidine-4-carboxamide |
| Synonyms | Source |
|---|---|
| AZD 5363 | DrugBank |
| AZD-5363 | DrugBank |
| AZD5363 | DrugBank |
| (S)-4-amino-N-(1-(4-chlorophenyl)-3-hydroxypropyl)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidine-4-carboxamide | ChEBI |
| Brand Name | Source |
|---|---|
| Truqap | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 0XZ | PDBeChem |
| Capivasertib | Wikipedia |
| D11371 | KEGG DRUG |
| DB12218 | DrugBank |
| HMDB0248786 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1143532-39-1 | KEGG DRUG |
| Citations |
|---|