EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19N3O5 |
| Net Charge | 0 |
| Average Mass | 393.399 |
| Monoisotopic Mass | 393.13247 |
| SMILES | CNC(=O)c1c(C)oc2cc(Oc3ncnc4cc(OC)c(OC)cc34)ccc12 |
| InChI | InChI=1S/C21H19N3O5/c1-11-19(20(25)22-2)13-6-5-12(7-16(13)28-11)29-21-14-8-17(26-3)18(27-4)9-15(14)23-10-24-21/h5-10H,1-4H3,(H,22,25) |
| InChIKey | BALLNEJQLSTPIO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | vascular endothelial growth factor receptor antagonist An antagonist at the vascular endothelial growth factor receptor. EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fruquintinib (CHEBI:229221) has role antineoplastic agent (CHEBI:35610) |
| fruquintinib (CHEBI:229221) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| fruquintinib (CHEBI:229221) has role vascular endothelial growth factor receptor antagonist (CHEBI:65207) |
| fruquintinib (CHEBI:229221) is a 1-benzofurans (CHEBI:38830) |
| fruquintinib (CHEBI:229221) is a aromatic ether (CHEBI:35618) |
| fruquintinib (CHEBI:229221) is a quinazolines (CHEBI:38530) |
| fruquintinib (CHEBI:229221) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 6-[(6,7-dimethoxyquinazolin-4-yl)oxy]-N,2-dimethyl-1-benzofuran-3-carboxamide |
| INNs | Source |
|---|---|
| fruquintinib | WHO MedNet |
| fruquintinib | WHO MedNet |
| fruquintinib | WHO MedNet |
| fruquintinibum | WHO MedNet |
| Synonym | Source |
|---|---|
| HMPL-013 | DrugBank |
| Brand Name | Source |
|---|---|
| Fruzaqla | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D11977 | KEGG DRUG |
| DB11679 | DrugBank |
| Fruquintinib | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1194506-26-7 | KEGG DRUG |
| Citations |
|---|