EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18FN5O2 |
| Net Charge | 0 |
| Average Mass | 355.373 |
| Monoisotopic Mass | 355.14445 |
| SMILES | C[C@H]1CNC(=O)c2cnn3ccc(nc23)N[C@H](C)c2cc(F)ccc2O1 |
| InChI | InChI=1S/C18H18FN5O2/c1-10-8-20-18(25)14-9-21-24-6-5-16(23-17(14)24)22-11(2)13-7-12(19)3-4-15(13)26-10/h3-7,9-11H,8H2,1-2H3,(H,20,25)(H,22,23)/t10-,11+/m0/s1 |
| InChIKey | FIKPXCOQUIZNHB-WDEREUQCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| repotrectinib (CHEBI:229220) has role antineoplastic agent (CHEBI:35610) |
| repotrectinib (CHEBI:229220) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| repotrectinib (CHEBI:229220) is a azamacrocycle (CHEBI:52898) |
| repotrectinib (CHEBI:229220) is a cyclic ether (CHEBI:37407) |
| repotrectinib (CHEBI:229220) is a monofluorobenzenes (CHEBI:83575) |
| repotrectinib (CHEBI:229220) is a pyrazolopyrimidine (CHEBI:38669) |
| repotrectinib (CHEBI:229220) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (7S,13R)-11-fluoro-7,13-dimethyl-6,7,13,14-tetrahydro-1,15-ethenopyrazolo[4,3-f][1,4,8,10]benzoxatriazacyclotridecin-4(5H)-one |
| INNs | Source |
|---|---|
| repotrectinibum | WHO MedNet |
| repotrectinib | WHO MedNet |
| répotrectinib | WHO MedNet |
| repotrectinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| TPX-0005 | DrugBank |
| TPX 0005 | ChEBI |
| TPX0005 | ChEBI |
| Brand Name | Source |
|---|---|
| Augtyro | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| DB16826 | DrugBank |
| D11454 | KEGG DRUG |
| Repotrectinib | Wikipedia |
| 7GI | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:1802220-02-5 | KEGG DRUG |
| Citations |
|---|