EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H41F2N5O.2HBr |
| Net Charge | 0 |
| Average Mass | 651.479 |
| Monoisotopic Mass | 649.18024 |
| SMILES | Br.Br.CCC[C@H](N[C@H]1CCc2cc(F)cc(F)c2C1)C(=O)Nc1cn(C(C)(C)CNCC(C)(C)C)cn1 |
| InChI | InChI=1S/C27H41F2N5O.2BrH/c1-7-8-23(32-20-10-9-18-11-19(28)12-22(29)21(18)13-20)25(35)33-24-14-34(17-31-24)27(5,6)16-30-15-26(2,3)4;;/h11-12,14,17,20,23,30,32H,7-10,13,15-16H2,1-6H3,(H,33,35);2*1H/t20-,23-;;/m0../s1 |
| InChIKey | LXEYYZYDWLAIPW-KBVFCZPLSA-N |
| Roles Classification |
|---|
| Biological Role: | gamma-secretase modulator A modulator of γ-secretase, one of the three endopeptidases that are specific for amyloid protein precursor and which have been identified based upon the region of the amyloid protein precursor which they cleave. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nirogacestat dihydrobromide (CHEBI:229218) has part nirogacestat(2+) (CHEBI:229219) |
| nirogacestat dihydrobromide (CHEBI:229218) has role antineoplastic agent (CHEBI:35610) |
| nirogacestat dihydrobromide (CHEBI:229218) has role γ-secretase modulator (CHEBI:48668) |
| nirogacestat dihydrobromide (CHEBI:229218) is a hydrobromide (CHEBI:48367) |
| IUPAC Name |
|---|
| N2-[(2S)-6,8-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]-N-(1-{1-[(2,2-dimethylpropyl)amino]-2-methylpropan-2-yl}-1H-imidazol-4-yl)-L-norvalinamide dihydrobromide |
| Synonyms | Source |
|---|---|
| (2S)-2-[[(2S)-6,8-difluoro-1,2,3,4-tetrahydro-2-naphthalenyl]amino]-N-[1-[2-[(2,2-dimethylpropyl)amino]-1,1-dimethylethyl]-1H-imidazol-4-yl]-pentanamide hydrobromide | ChEBI |
| (S)-2-(((S)-6,8-Difluoro-1,2,3,4-tetrahydronaphthalen-2-yl)amino)-N-(1-(2-methyl-1-(neopentylamino)propan-2-yl)-1H-imidazol-4-yl) pentanamide dihydrobromide | ChEBI |
| nirogacestat 2HBr | ChEBI |
| nirogacestat HBr | ChEBI |
| nirogacestat hydrobromide | ChEBI |
| PF 03084014 hydrobromide | ChEBI |
| Brand Name | Source |
|---|---|
| Ogsiveo | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:1962925-29-6 | ChEBI |
| Citations |
|---|