EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H41F2N5O |
| Net Charge | 0 |
| Average Mass | 489.655 |
| Monoisotopic Mass | 489.32792 |
| SMILES | CCC[C@H](N[C@H]1CCc2cc(F)cc(F)c2C1)C(=O)Nc1cn(C(C)(C)CNCC(C)(C)C)cn1 |
| InChI | InChI=1S/C27H41F2N5O/c1-7-8-23(32-20-10-9-18-11-19(28)12-22(29)21(18)13-20)25(35)33-24-14-34(17-31-24)27(5,6)16-30-15-26(2,3)4/h11-12,14,17,20,23,30,32H,7-10,13,15-16H2,1-6H3,(H,33,35)/t20-,23-/m0/s1 |
| InChIKey | VFCRKLWBYMDAED-REWPJTCUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | gamma-secretase modulator A modulator of γ-secretase, one of the three endopeptidases that are specific for amyloid protein precursor and which have been identified based upon the region of the amyloid protein precursor which they cleave. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nirogacestat (CHEBI:229217) has role antineoplastic agent (CHEBI:35610) |
| nirogacestat (CHEBI:229217) has role γ-secretase modulator (CHEBI:48668) |
| nirogacestat (CHEBI:229217) is a imidazoles (CHEBI:24780) |
| nirogacestat (CHEBI:229217) is a organofluorine compound (CHEBI:37143) |
| nirogacestat (CHEBI:229217) is a secondary amino compound (CHEBI:50995) |
| nirogacestat (CHEBI:229217) is a secondary carboxamide (CHEBI:140325) |
| nirogacestat (CHEBI:229217) is a tetralins (CHEBI:36786) |
| nirogacestat (CHEBI:229217) is conjugate base of nirogacestat(2+) (CHEBI:229219) |
| Incoming Relation(s) |
| nirogacestat(2+) (CHEBI:229219) is conjugate acid of nirogacestat (CHEBI:229217) |
| IUPAC Name |
|---|
| N2-[(2S)-6,8-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]-N-(1-{1-[(2,2-dimethylpropyl)amino]-2-methylpropan-2-yl}-1H-imidazol-4-yl)-L-norvalinamide |
| INNs | Source |
|---|---|
| nirogacestat | WHO MedNet |
| nirogacestat | WHO MedNet |
| nirogacéstat | WHO MedNet |
| nirogacestatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (2S)-2-{[(2S)-6,8-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]amino}-N-(1-{1-[(2,2-dimethylpropyl)amino]-2-methylpropan-2-yl}-1H-imidazol-4-yl)pentanamide | IUPAC |
| (S)-2-((S)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-3-ylamino)-N-(1-(2-methyl-1-(neopentylamino)propan-2-yl)-1H-imidazol-4-yl)pentanamide | ChEBI |
| PF-03084014 | DrugBank |
| PF-3084014 | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D10960 | KEGG DRUG |
| DB12005 | DrugBank |
| HMDB0255626 | HMDB |
| Nirogacestat | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1290543-63-3 | KEGG DRUG |
| Citations |
|---|