EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H38N2O2 |
| Net Charge | 0 |
| Average Mass | 458.646 |
| Monoisotopic Mass | 458.29333 |
| SMILES | [H][C@@]1(c2ccc(OC)cc2N(CC)Cc2ccc(CCNCC)cc2)CCc2cc(O)ccc2C1 |
| InChI | InChI=1S/C30H38N2O2/c1-4-31-17-16-22-6-8-23(9-7-22)21-32(5-2)30-20-28(34-3)14-15-29(30)26-11-10-25-19-27(33)13-12-24(25)18-26/h6-9,12-15,19-20,26,31,33H,4-5,10-11,16-18,21H2,1-3H3/t26-/m1/s1 |
| InChIKey | SIFNOOUKXBRGGB-AREMUKBSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | estrogen receptor antagonist An antagonist at the estrogen receptor. |
| Applications: | anti-estrogen A drug which acts to reduce estrogenic activity in the body, either by reducing the amount of estrogen or by reducing the activity of whatever estrogen is present. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. estrogen receptor antagonist An antagonist at the estrogen receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elacestrant (CHEBI:229213) has role anti-estrogen (CHEBI:50751) |
| elacestrant (CHEBI:229213) has role antineoplastic agent (CHEBI:35610) |
| elacestrant (CHEBI:229213) has role estrogen receptor antagonist (CHEBI:50792) |
| elacestrant (CHEBI:229213) is a monomethoxybenzene (CHEBI:25235) |
| elacestrant (CHEBI:229213) is a organic hydroxy compound (CHEBI:33822) |
| elacestrant (CHEBI:229213) is a secondary amino compound (CHEBI:50995) |
| elacestrant (CHEBI:229213) is a substituted aniline (CHEBI:48975) |
| elacestrant (CHEBI:229213) is a tertiary amino compound (CHEBI:50996) |
| elacestrant (CHEBI:229213) is a tetralins (CHEBI:36786) |
| IUPAC Name |
|---|
| (6R)-6-[2-(ethyl{4-[2-(ethylamino)ethyl]benzyl}amino)-4-methoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| INNs | Source |
|---|---|
| elacestrant | WHO MedNet |
| elacestrant | WHO MedNet |
| élacestrant | WHO MedNet |
| elacestrantum | WHO MedNet |
| Synonyms | Source |
|---|---|
| ER-306323 | DrugBank |
| (R)-6-(2-(ethyl(4-(2-(ethylamino)ethyl)benzyl)amino)-4-methoxyphenyl)-5,6,7,8-tetrahydronaphthalen-2-ol | ChEBI |
| RAD 1901 | ChEBI |
| RAD-1901 | DrugBank |
| RAD1901 | DrugBank |
| Brand Name | Source |
|---|---|
| Orserdu | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D11671 | KEGG DRUG |
| DB06374 | DrugBank |
| Elacestrant | Wikipedia |
| I0V | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:722533-56-4 | KEGG DRUG |
| Citations |
|---|