EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17NO3 |
| Net Charge | 0 |
| Average Mass | 223.272 |
| Monoisotopic Mass | 223.12084 |
| SMILES | C[N+](C)(C)CCc1ccc([O-])cc1C(=O)O |
| InChI | InChI=1S/C12H17NO3/c1-13(2,3)7-6-9-4-5-10(14)8-11(9)12(15)16/h4-5,8H,6-7H2,1-3H3,(H-,14,15,16) |
| InChIKey | HTCQNXQVACMNDD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Maokonine (CHEBI:229162) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 3-carboxy-4-[2-(trimethylazaniumyl)ethyl]phenolate |
| Manual Xrefs | Databases |
|---|---|
| 166604 | ChemSpider |