EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H26O12 |
| Net Charge | 0 |
| Average Mass | 530.482 |
| Monoisotopic Mass | 530.14243 |
| SMILES | COC(=O)C1(O)CC(O)C(OC(=O)/C=C/c2ccc(O)c(O)c2)C(OC(=O)/C=C/c2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C26H26O12/c1-36-25(34)26(35)12-20(31)24(38-23(33)9-5-15-3-7-17(28)19(30)11-15)21(13-26)37-22(32)8-4-14-2-6-16(27)18(29)10-14/h2-11,20-21,24,27-31,35H,12-13H2,1H3/b8-4+,9-5+ |
| InChIKey | PKJBSZTYNDRXEQ-KBXRYBNXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Macranthoin F (CHEBI:229159) is a quinic acid (CHEBI:26493) |
| IUPAC Name |
|---|
| methyl 3,4-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-1,5-dihydroxycyclohexane-1-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 4477533 | ChemSpider |