EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H27NO4 |
| Net Charge | 0 |
| Average Mass | 321.417 |
| Monoisotopic Mass | 321.19401 |
| SMILES | C/C=C(\C)C(=O)O[C@H]1CC2C[C@H](OC(=O)/C(C)=C/C)C(C1)N2C |
| InChI | InChI=1S/C18H27NO4/c1-6-11(3)17(20)22-14-8-13-9-16(15(10-14)19(13)5)23-18(21)12(4)7-2/h6-7,13-16H,8-10H2,1-5H3/b11-6+,12-7+/t13?,14-,15?,16-/m0/s1 |
| InChIKey | MJJVORBCNQQRMU-VZITZHEYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-3alpha,6beta-Ditigloyloxytropane (CHEBI:229152) is a tropane alkaloid (CHEBI:37332) |
| IUPAC Name |
|---|
| [(3S,6S)-8-methyl-6-[(E)-2-methylbut-2-enoyl]oxy-8-azabicyclo[3.2.1]octan-3-yl] (E)-2-methylbut-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 4475899 | ChemSpider |