EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H35NO5 |
| Net Charge | 0 |
| Average Mass | 393.524 |
| Monoisotopic Mass | 393.25152 |
| SMILES | [H][C@]12C[C@]3(O)C(C1O)[C@](O)(C[C@@H]2OC)[C@]1([H])C[C@@]2([H])C34C(O)CC[C@@]2(C)CN(CC)C41 |
| InChI | InChI=1S/C22H35NO5/c1-4-23-10-19(2)6-5-15(24)22-14(19)7-12(18(22)23)20(26)9-13(28-3)11-8-21(22,27)17(20)16(11)25/h11-18,24-27H,4-10H2,1-3H3/t11-,12-,13+,14-,15?,16?,17?,18?,19+,20+,21+,22?/m1/s1 |
| InChIKey | PFSQFYVYGQKXRF-NVIQIUFPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Karacolidine (CHEBI:229149) has functional parent aconitane (CHEBI:35911) |
| Karacolidine (CHEBI:229149) is a diterpene alkaloid (CHEBI:23847) |
| IUPAC Name |
|---|
| (2S,5S,6S,8S,9R,13R,17R)-11-ethyl-6-methoxy-13-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-2,4,8,16-tetrol |
| Manual Xrefs | Databases |
|---|---|
| 4477262 | ChemSpider |