EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13NO3 |
| Net Charge | 0 |
| Average Mass | 171.196 |
| Monoisotopic Mass | 171.08954 |
| SMILES | CC(=O)N[C@H]1C(=O)O[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C8H13NO3/c1-4-5(2)12-8(11)7(4)9-6(3)10/h4-5,7H,1-3H3,(H,9,10)/t4-,5+,7+/m0/s1 |
| InChIKey | ZPMSJPDTFABBSV-HBPOCXIASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Desmodilactone (CHEBI:229101) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| N-[(3R,4R,5R)-4,5-dimethyl-2-oxooxolan-3-yl]acetamide |
| Manual Xrefs | Databases |
|---|---|
| 166333 | ChemSpider |