EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H45NO2 |
| Net Charge | 0 |
| Average Mass | 415.662 |
| Monoisotopic Mass | 415.34503 |
| SMILES | [H][C@@]12CC[C@@]3([H])[C@@H](C)[C@]4([H])CC[C@H](C)CN4C[C@@]3([H])[C@]1([H])C[C@@]1([H])[C@@]2([H])C[C@@H](O)[C@@]2([H])C[C@@H](O)CC[C@]12C |
| InChI | InChI=1S/C27H45NO2/c1-15-4-7-25-16(2)18-5-6-19-20(22(18)14-28(25)13-15)11-23-21(19)12-26(30)24-10-17(29)8-9-27(23,24)3/h15-26,29-30H,4-14H2,1-3H3/t15-,16+,17-,18-,19+,20+,21-,22+,23-,24+,25-,26+,27+/m0/s1 |
| InChIKey | NEMWYOKGHGSVSC-MSSYMPDSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Delavine (CHEBI:229097) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| (1R,2S,6S,9S,10R,11R,14S,15S,17R,18S,20S,23R,24S)-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosane-17,20-diol |
| Manual Xrefs | Databases |
|---|---|
| 10264360 | ChemSpider |