EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:229084 - Codopiloic acid
| Formula | C5H5NO3 |
| Net Charge | 0 |
| Average Mass | 127.099 |
| Monoisotopic Mass | 127.02694 |
| SMILES | O=C(O)C1=NC=COC1 |
| InChI | InChI=1S/C5H5NO3/c7-5(8)4-3-9-2-1-6-4/h1-2H,3H2,(H,7,8) |
| InChIKey | SYTGUXGLBXTALU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Codopiloic acid (CHEBI:229084) is a azetidine-2-carboxylic acid (CHEBI:38108) |
| Codopiloic acid (CHEBI:229084) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| IUPAC Name |
|---|
| 2H-1,4-oxazine-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 155269 | ChemSpider |