EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13NO4 |
| Net Charge | 0 |
| Average Mass | 175.184 |
| Monoisotopic Mass | 175.08446 |
| SMILES | O[C@@H]1[C@@H](O)[C@]2(O)CCC(N2)[C@@H]1O |
| InChI | InChI=1S/C7H13NO4/c9-4-3-1-2-7(12,8-3)6(11)5(4)10/h3-6,8-12H,1-2H2/t3?,4-,5-,6+,7+/m0/s1 |
| InChIKey | FXFBVZOJVHCEDO-NGMGSTNOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Calistegin B2 (CHEBI:229074) is a tropane alkaloid (CHEBI:37332) |
| IUPAC Name |
|---|
| (1R,2R,3S,4S)-8-azabicyclo[3.2.1]octane-1,2,3,4-tetrol |