EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H15NO5 |
| Net Charge | 0 |
| Average Mass | 337.331 |
| Monoisotopic Mass | 337.09502 |
| SMILES | CCOc1c2c3c(cc4c(c3c3cccc(OC)c13)OCO4)C(=O)N2 |
| InChI | InChI=1S/C19H15NO5/c1-3-23-18-13-9(5-4-6-11(13)22-2)15-14-10(19(21)20-16(14)18)7-12-17(15)25-8-24-12/h4-7H,3,8H2,1-2H3,(H,20,21) |
| InChIKey | YFTVKUKOLZCKAN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-Ethoxy-aristololactam (CHEBI:229040) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| 12-ethoxy-14-methoxy-3,5-dioxa-10-azapentacyclo[9.7.1.02,6.08,19.013,18]nonadeca-1(19),2(6),7,11,13(18),14,16-heptaen-9-one |
| Manual Xrefs | Databases |
|---|---|
| 169410 | ChemSpider |