EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26N8O5 |
| Net Charge | 0 |
| Average Mass | 422.446 |
| Monoisotopic Mass | 422.20262 |
| SMILES | [H][C@]1(n2ccc(N)nc2=O)C=C[C@H](NC(=O)C[C@@H](N)CCN(C)C(=N)N)[C@@]([H])(C(=O)O)O1 |
| InChI | InChI=1S/C17H26N8O5/c1-24(16(20)21)6-4-9(18)8-12(26)22-10-2-3-13(30-14(10)15(27)28)25-7-5-11(19)23-17(25)29/h2-3,5,7,9-10,13-14H,4,6,8,18H2,1H3,(H3,20,21)(H,22,26)(H,27,28)(H2,19,23,29)/t9-,10-,13+,14-/m0/s1 |
| InChIKey | CXNPLSGKWMLZPZ-ZNIXKSQXSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces griseochromogenes (ncbitaxon:68214) | - | PubMed (12964155) |
| Roles Classification |
|---|
| Biological Roles: | fungicide A substance used to destroy fungal pests. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| blasticidin S (CHEBI:15353) has role antimicrobial agent (CHEBI:33281) |
| blasticidin S (CHEBI:15353) has role bacterial metabolite (CHEBI:76969) |
| blasticidin S (CHEBI:15353) has role fungicide (CHEBI:24127) |
| blasticidin S (CHEBI:15353) has role protein synthesis inhibitor (CHEBI:48001) |
| blasticidin S (CHEBI:15353) is a antibiotic antifungal agent (CHEBI:86478) |
| blasticidin S (CHEBI:15353) is a blasticidin (CHEBI:22905) |
| blasticidin S (CHEBI:15353) is conjugate base of blasticidin S(1+) (CHEBI:57289) |
| Incoming Relation(s) |
| acetylblasticidin S (CHEBI:2413) has functional parent blasticidin S (CHEBI:15353) |
| blasticidin S(1+) (CHEBI:57289) is conjugate acid of blasticidin S (CHEBI:15353) |
| IUPAC Name |
|---|
| 4-amino-1-(4-{[(3S)-3-amino-5-(N-methylcarbamimidamido)pentanoyl]amino}-2,3,4-trideoxy-β-D-erythro-hex-2-enopyranuronosyl)pyrimidin-2(1H)-one |
| Synonyms | Source |
|---|---|
| Blasticidin S | KEGG COMPOUND |
| Blasticidin-S | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| blasticidin-s | MetaCyc |
| blasticidin-s | Alan Wood's Pesticides |
| Blasticidin_S | Wikipedia |
| BLS | PDBeChem |
| C00016063 | KNApSAcK |
| C00027948 | KNApSAcK |
| C02010 | KEGG COMPOUND |
| C02010 | KEGG COMPOUND |
| HMDB0030452 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:68255 | Reaxys |
| CAS:2079-00-7 | ChemIDplus |
| CAS:2079-00-7 | KEGG COMPOUND |
| Citations |
|---|