EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H43NO7 |
| Net Charge | 0 |
| Average Mass | 481.630 |
| Monoisotopic Mass | 481.30395 |
| SMILES | CCN1C[C@]2(CO)CCC(OC)C34C5CC6C(OC)C5[C@](OC)(C[C@@H]6OC)C(O)(C(OC)C32)C14 |
| InChI | InChI=1S/C26H43NO7/c1-7-27-12-23(13-28)9-8-17(31-3)25-15-10-14-16(30-2)11-24(34-6,18(15)19(14)32-4)26(29,22(25)27)21(33-5)20(23)25/h14-22,28-29H,7-13H2,1-6H3/t14?,15?,16-,17?,18?,19?,20?,21?,22?,23-,24+,25?,26?/m0/s1 |
| InChIKey | ZSZBLSHAQNIIEE-VTLHUVBLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-Methyllycoctonine (CHEBI:229039) has functional parent aconitane (CHEBI:35911) |
| 8-Methyllycoctonine (CHEBI:229039) is a diterpene alkaloid (CHEBI:23847) |
| IUPAC Name |
|---|
| (6S,8R,13S)-11-ethyl-13-(hydroxymethyl)-4,6,8,16,18-pentamethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-9-ol |