EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H26O4 |
| Net Charge | 0 |
| Average Mass | 438.523 |
| Monoisotopic Mass | 438.18311 |
| SMILES | COc1cc(O)c(Cc2ccc(O)cc2)c(/C=C/c2ccccc2)c1Cc1ccc(O)cc1 |
| InChI | InChI=1S/C29H26O4/c1-33-29-19-28(32)26(17-21-7-12-23(30)13-8-21)25(16-11-20-5-3-2-4-6-20)27(29)18-22-9-14-24(31)15-10-22/h2-16,19,30-32H,17-18H2,1H3/b16-11+ |
| InChIKey | JPOSRDXMWOPQOV-LFIBNONCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Methoxy-3-(2-phenyl-E-E-ethenyl)-2,4-bis(4-hydroxybenzyl) phenol (CHEBI:229021) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 2,4-bis[(4-hydroxyphenyl)methyl]-5-methoxy-3-[(E)-2-phenylethenyl]phenol |
| Manual Xrefs | Databases |
|---|---|
| 4477772 | ChemSpider |