EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14N2O2 |
| Net Charge | 0 |
| Average Mass | 254.289 |
| Monoisotopic Mass | 254.10553 |
| SMILES | C=Cc1ncc(OC)c2c3ccccc3n(OC)c12 |
| InChI | InChI=1S/C15H14N2O2/c1-4-11-15-14(13(18-2)9-16-11)10-7-5-6-8-12(10)17(15)19-3/h4-9H,1H2,2-3H3 |
| InChIKey | IOKBUNVDGRBBPU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,9-Dimethoxy-1-vinyl-beta-carboline (CHEBI:229014) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| 1-ethenyl-4,9-dimethoxypyrido[3,4-b]indole |
| Manual Xrefs | Databases |
|---|---|
| 4475845 | ChemSpider |