EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O2 |
| Net Charge | 0 |
| Average Mass | 288.431 |
| Monoisotopic Mass | 288.20893 |
| SMILES | [H][C@@]12CCC3=C[C@H](O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)C(=O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,13-16,20H,3-10H2,1-2H3/t13-,14+,15+,16+,18+,19+/m1/s1 |
| InChIKey | VMYTXBKVYDESSJ-HKQXQEGQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3alpha-Hydroxy-androst-4-ene-17-one (CHEBI:229005) has role androgen (CHEBI:50113) |
| 3alpha-Hydroxy-androst-4-ene-17-one (CHEBI:229005) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (3R,8R,9S,10R,13S,14S)-3-hydroxy-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| Manual Xrefs | Databases |
|---|---|
| 5290638 | ChemSpider |