EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16O2 |
| Net Charge | 0 |
| Average Mass | 156.225 |
| Monoisotopic Mass | 156.11503 |
| SMILES | CCCCCCC=CC(=O)O |
| InChI | InChI=1S/C9H16O2/c1-2-3-4-5-6-7-8-9(10)11/h7-8H,2-6H2,1H3,(H,10,11) |
| InChIKey | ADLXTJMPCFOTOO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Nonenic acid (CHEBI:228993) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| non-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 88206 | ChemSpider |
| LMFA01030026 | LIPID MAPS |