EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N2O |
| Net Charge | 0 |
| Average Mass | 310.441 |
| Monoisotopic Mass | 310.20451 |
| SMILES | CC[C@@]1(C)CN(C)C2Cc3c(nc4ccccc34)C(=O)CC1C2 |
| InChI | InChI=1S/C20H26N2O/c1-4-20(2)12-22(3)14-9-13(20)10-18(23)19-16(11-14)15-7-5-6-8-17(15)21-19/h5-8,13-14,21H,4,9-12H2,1-3H3/t13?,14?,20-/m0/s1 |
| InChIKey | MPSCNETWEOFXDJ-DHRDCHLVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-Epi-19,20-dihydro-decarbomethoxy vobasine (CHEBI:228979) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| (15R)-15-ethyl-15,17-dimethyl-10,17-diazatetracyclo[12.3.1.03,11.04,9]octadeca-3(11),4,6,8-tetraen-12-one |
| Manual Xrefs | Databases |
|---|---|
| 4475993 | ChemSpider |