EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10N2O2 |
| Net Charge | 0 |
| Average Mass | 118.136 |
| Monoisotopic Mass | 118.07423 |
| SMILES | CC(N)C(N)C(=O)O |
| InChI | InChI=1S/C4H10N2O2/c1-2(5)3(6)4(7)8/h2-3H,5-6H2,1H3,(H,7,8) |
| InChIKey | SXGMVGOVILIERA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-Diaminobutyric acid (CHEBI:228968) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2,3-diaminobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4475641 | ChemSpider |