EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10N2O |
| Net Charge | 0 |
| Average Mass | 198.225 |
| Monoisotopic Mass | 198.07931 |
| SMILES | OCc1nccc2c1nc1ccccc12 |
| InChI | InChI=1S/C12H10N2O/c15-7-11-12-9(5-6-13-11)8-3-1-2-4-10(8)14-12/h1-6,14-15H,7H2 |
| InChIKey | XKCXIUDPGSNQIQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-Hydroxymethyl-beta-carboline (CHEBI:228962) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| 9H-pyrido[3,4-b]indol-1-ylmethanol |
| Manual Xrefs | Databases |
|---|---|
| 4476892 | ChemSpider |