EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26N2O3 |
| Net Charge | 0 |
| Average Mass | 378.472 |
| Monoisotopic Mass | 378.19434 |
| SMILES | [H][C@]12[C@@]3([H])C[C@]4(OCC)N5CCC46c4ccccc4N(C(=O)C[C@]1([H])OCC=C3C5)[C@]62[H] |
| InChI | InChI=1S/C23H26N2O3/c1-2-28-23-12-15-14-7-10-27-18-11-19(26)25-17-6-4-3-5-16(17)22(23,21(25)20(15)18)8-9-24(23)13-14/h3-7,15,18,20-21H,2,8-13H2,1H3/t15-,18-,20-,21-,22?,23+/m0/s1 |
| InChIKey | BWCUFELTNOPYLM-KWNWVHFBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16-Ethoxystrychnine (CHEBI:228953) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| (4aR,5aR,13aS,15aS,15bR)-5a-ethoxy-2,4a,5,7,8,13a,15,15a,15b,16-decahydro4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinolin-14-one |
| Manual Xrefs | Databases |
|---|---|
| 173153 | ChemSpider |