EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N2O3 |
| Net Charge | 0 |
| Average Mass | 302.374 |
| Monoisotopic Mass | 302.16304 |
| SMILES | CC(=O)OC1CCN2CC3CC(Cn4c3cccc4=O)C2C1 |
| InChI | InChI=1S/C17H22N2O3/c1-11(20)22-14-5-6-18-9-12-7-13(16(18)8-14)10-19-15(12)3-2-4-17(19)21/h2-4,12-14,16H,5-10H2,1H3 |
| InChIKey | WOXXKFZZPFAEHI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13-O-Acetylbaptifoline (CHEBI:228950) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| (14-oxo-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-10,12-dien-4-yl) acetate |
| Manual Xrefs | Databases |
|---|---|
| 138189 | ChemSpider |