EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H48MoN20O27P4S4 |
| Net Charge | 0 |
| Average Mass | 1589.041 |
| Monoisotopic Mass | 1589.98851 |
| SMILES | [H][C@@]12Nc3c(nc(N)nc3=O)N[C@]1([H])O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n3cnc4c(=O)nc(N)nc43)[C@H](O)[C@@H]1O)C1=C2[S][Mo]2(=[O])([S]1)[S]C1=C([S]2)[C@]2([H])Nc3c(nc(N)nc3=O)N[C@]2([H])O[C@@H]1COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(=O)nc(N)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/2C20H26N10O13P2S2.Mo.O/c2*21-19-26-13-7(15(33)28-19)24-6-12(47)11(46)5(41-17(6)25-13)2-40-45(37,38)43-44(35,36)39-1-4-9(31)10(32)18(42-4)30-3-23-8-14(30)27-20(22)29-16(8)34;;/h2*3-6,9-10,17-18,24,31-32,46-47H,1-2H2,(H,35,36)(H,37,38)(H3,22,27,29,34)(H4,21,25,26,28,33);;/q;;+4;/p-4/t2*4-,5-,6+,9-,10-,17-,18-;;/m11../s1 |
| InChIKey | SPLYCLQDZVSNSU-HWCCSRDCSA-J |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mo(=O)-bis(molybdopterin guanine dinucleotide) (CHEBI:22894) is a Mo-molybdopterin cofactor (CHEBI:21437) |
| Mo(=O)-bis(molybdopterin guanine dinucleotide) (CHEBI:22894) is a molybdopterin dinucleotide (CHEBI:37146) |
| Mo(=O)-bis(molybdopterin guanine dinucleotide) (CHEBI:22894) is conjugate acid of Mo(=O)-bis(molybdopterin guanine dinucleotide)(4−) (CHEBI:60539) |
| Incoming Relation(s) |
| Mo(=O)-bis(molybdopterin guanine dinucleotide)(4−) (CHEBI:60539) is conjugate base of Mo(=O)-bis(molybdopterin guanine dinucleotide) (CHEBI:22894) |
| IUPAC Name |
|---|
| bis{5'-O-[{[{[(5aR,8R,9aR)-2-amino-4-oxo-6,7-bis(sulfanyl-κS)-3,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methoxy}(hydroxy)phosphoryl]oxy}(hydroxy)phosphoryl]guanosinato(2−)}(oxido)molybdenum |
| Synonyms | Source |
|---|---|
| bis(molybdopterin guanine dinucleotide)molybdenum | ChEBI |
| Mo(Dtpp-mGDP)2 | ChEBI |
| molybdate-bis(molybdopterin guanine dinucleotide) | ChEBI |