EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19NO4 |
| Net Charge | 0 |
| Average Mass | 313.353 |
| Monoisotopic Mass | 313.13141 |
| SMILES | [H][C@]12Cc3cc(OC)c(O)cc3-c3c(OC)c(O)cc(c31)CCN2 |
| InChI | InChI=1S/C18H19NO4/c1-22-15-7-10-5-12-16-9(3-4-19-12)6-14(21)18(23-2)17(16)11(10)8-13(15)20/h6-8,12,19-21H,3-5H2,1-2H3/t12-/m0/s1 |
| InChIKey | URQAEFLEDPPPFX-LBPRGKRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Laetanine (CHEBI:228883) is a isoquinoline alkaloid (CHEBI:24921) |
| IUPAC Name |
|---|
| (6aS)-1,9-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,10-diol |
| Manual Xrefs | Databases |
|---|---|
| 60600119 | ChemSpider |