EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19NO4 |
| Net Charge | 0 |
| Average Mass | 289.331 |
| Monoisotopic Mass | 289.13141 |
| SMILES | [H][C@@]12CCN3Cc4cc5c(cc4[C@]([H])([C@H](O)[C@@H](O)C1)[C@]32[H])OCO5 |
| InChI | InChI=1S/C16H19NO4/c18-11-3-8-1-2-17-6-9-4-12-13(21-7-20-12)5-10(9)14(15(8)17)16(11)19/h4-5,8,11,14-16,18-19H,1-3,6-7H2/t8-,11+,14+,15-,16-/m1/s1 |
| InChIKey | VJILFEGOWCJNIK-MGRBZGILSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dihydrolycorine (CHEBI:228864) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| (1S,15R,17S,18S,19R)-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-2,4(8),9-triene-17,18-diol |
| Manual Xrefs | Databases |
|---|---|
| 10050463 | ChemSpider |