EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21NO4 |
| Net Charge | 0 |
| Average Mass | 339.391 |
| Monoisotopic Mass | 339.14706 |
| SMILES | [H][C@@]12Cc3c(ccc(OC)c3OC)-c3c4c(cc(c31)CCN2C)OCO4 |
| InChI | InChI=1S/C20H21NO4/c1-21-7-6-11-8-16-20(25-10-24-16)18-12-4-5-15(22-2)19(23-3)13(12)9-14(21)17(11)18/h4-5,8,14H,6-7,9-10H2,1-3H3/t14-/m1/s1 |
| InChIKey | UVDQDNQWGQFIAO-CQSZACIVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Crebanine (CHEBI:228860) is a isoquinoline alkaloid (CHEBI:24921) |
| IUPAC Name |
|---|
| (12R)-15,16-dimethoxy-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene |
| Manual Xrefs | Databases |
|---|---|
| 295564 | ChemSpider |