EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26N2O4S |
| Net Charge | 0 |
| Average Mass | 354.472 |
| Monoisotopic Mass | 354.16133 |
| SMILES | CC(C)(C)c1ccc(C(=O)ON=C(N)CS(=O)(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H26N2O4S/c1-16(2,3)13-9-7-12(8-10-13)15(20)23-19-14(18)11-24(21,22)17(4,5)6/h7-10H,11H2,1-6H3,(H2,18,19) |
| InChIKey | ICWLEGNPHRIEGC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O1-[4-(tert-butyl)benzoyl]-2-(tert-butylsulfonyl)ethanehydroximamide (CHEBI:228833) is a benzoic acids (CHEBI:22723) |
| IUPAC Name |
|---|
| [(1-amino-2-tert-butylsulonylethylidene)amino] 4-tert-butylbenzoate |
| Manual Xrefs | Databases |
|---|---|
| 2097852 | ChemSpider |