EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N2 |
| Net Charge | 0 |
| Average Mass | 114.192 |
| Monoisotopic Mass | 114.11570 |
| SMILES | N[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C6H14N2/c7-5-3-1-2-4-6(5)8/h5-6H,1-4,7-8H2/t5-,6-/m1/s1 |
| InChIKey | SSJXIUAHEKJCMH-PHDIDXHHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DNH (CHEBI:228823) is a amine (CHEBI:32952) |
| IUPAC Name |
|---|
| (1R,2R)-cyclohexane-1,2-diamine |