EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N4O2 |
| Net Charge | 0 |
| Average Mass | 286.335 |
| Monoisotopic Mass | 286.14298 |
| SMILES | O=c1ncc(N2CCN(Cc3ccccc3)CC2)c(=O)n1 |
| InChI | InChI=1S/C15H18N4O2/c20-14-13(10-16-15(21)17-14)19-8-6-18(7-9-19)11-12-4-2-1-3-5-12/h1-5,10H,6-9,11H2,(H2,16,17,20,21) |
| InChIKey | BQUYEGDTBNEKRQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(4-benzylpiperazino)-2,4(1H,3H)-pyrimidinedione (CHEBI:228820) is a N-arylpiperazine (CHEBI:46848) |
| IUPAC Name |
|---|
| 5-(4-benzylpiperazin-1-yl)-1H-pyrimidine-2,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 2093371 | ChemSpider |