EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10N2O2 |
| Net Charge | 0 |
| Average Mass | 202.213 |
| Monoisotopic Mass | 202.07423 |
| SMILES | CC1=NOC(=O)C1=CNc1ccccc1 |
| InChI | InChI=1S/C11H10N2O2/c1-8-10(11(14)15-13-8)7-12-9-5-3-2-4-6-9/h2-7,12H,1H3 |
| InChIKey | NMNHLPXEDWSVJU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | exometabolome | MetaboLights (MTBLS8903) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(anilinomethylidene)-3-methyl-4,5-dihydroisoxazol-5-one (CHEBI:228817) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 4-(anilinomethylidene)-3-methyl-1,2-oxazol-5-one |
| Manual Xrefs | Databases |
|---|---|
| 5143032 | ChemSpider |