EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12N6O2 |
| Net Charge | 0 |
| Average Mass | 284.279 |
| Monoisotopic Mass | 284.10217 |
| SMILES | CNc1ccc([N+](=O)[O-])c(Nc2ccc3nncc3c2)n1 |
| InChI | InChI=1S/C13H12N6O2/c1-14-12-5-4-11(19(20)21)13(17-12)16-9-2-3-10-8(6-9)7-15-18-10/h2-7H,1H3,(H,15,18)(H2,14,16,17) |
| InChIKey | NDJJEQIMIJJCLL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | heat shock factor 1 inhibitor Any inhibitor that interferes with the action of heat shock factor 1. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| KRIBB11 (CHEBI:228800) has role antineoplastic agent (CHEBI:35610) |
| KRIBB11 (CHEBI:228800) has role apoptosis inducer (CHEBI:68495) |
| KRIBB11 (CHEBI:228800) has role heat shock factor 1 inhibitor (CHEBI:228801) |
| KRIBB11 (CHEBI:228800) is a C-nitro compound (CHEBI:35716) |
| KRIBB11 (CHEBI:228800) is a aminopyridine (CHEBI:38207) |
| KRIBB11 (CHEBI:228800) is a aromatic amine (CHEBI:33860) |
| KRIBB11 (CHEBI:228800) is a indazoles (CHEBI:38769) |
| IUPAC Name |
|---|
| N2-(1H-indazol-5-yl)-N6-methyl-3-nitropyridine-2,6-diamine |
| Synonym | Source |
|---|---|
| N2-1H-indazol-5-yl-N6-methyl-3-nitro-2,6-pyridinediamine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:342639-96-7 | ChEBI |
| Citations |
|---|