EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15NO8 |
| Net Charge | 0 |
| Average Mass | 325.273 |
| Monoisotopic Mass | 325.07977 |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)COCC(=O)O)c1 |
| InChI | InChI=1S/C14H15NO8/c1-21-13(19)8-3-4-9(14(20)22-2)10(5-8)15-11(16)6-23-7-12(17)18/h3-5H,6-7H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | QSCUMDGEFTWAPV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-{2-[2,5-di(methoxycarbonyl)anilino]-2-oxoethoxy}acetic acid (CHEBI:228787) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| 2-[2-[2,5-bis(methoxycarbonyl)anilino]-2-oxoethoxy]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 2014674 | ChemSpider |