EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O10 |
| Net Charge | 0 |
| Average Mass | 446.408 |
| Monoisotopic Mass | 446.12130 |
| SMILES | COc1ccc(-c2coc3cc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc(O)c3c2=O)cc1 |
| InChI | InChI=1S/C22H22O10/c1-29-11-4-2-10(3-5-11)13-9-30-15-7-12(6-14(24)17(15)18(13)25)31-22-21(28)20(27)19(26)16(8-23)32-22/h2-7,9,16,19-24,26-28H,8H2,1H3/t16-,19-,20+,21-,22-/m1/s1 |
| InChIKey | LFEUICHQZGNOHD-RECXWPGBSA-N |
| Roles Classification |
|---|
| Biological Roles: | phytoestrogen Any compound produced by a plant that happens to have estrogenic activity. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| biochanin A 7-O-β-D-glucoside (CHEBI:28751) has functional parent biochanin A (CHEBI:17574) |
| biochanin A 7-O-β-D-glucoside (CHEBI:28751) has role phytoestrogen (CHEBI:76989) |
| biochanin A 7-O-β-D-glucoside (CHEBI:28751) has role plant metabolite (CHEBI:76924) |
| biochanin A 7-O-β-D-glucoside (CHEBI:28751) is a 4'-methoxyisoflavones (CHEBI:133959) |
| biochanin A 7-O-β-D-glucoside (CHEBI:28751) is a 7-hydroxyisoflavones 7-O-β-D-glucoside (CHEBI:140301) |
| biochanin A 7-O-β-D-glucoside (CHEBI:28751) is a hydroxyisoflavone (CHEBI:38755) |
| biochanin A 7-O-β-D-glucoside (CHEBI:28751) is conjugate acid of biochanin A 7-O-β-D-glucoside(1−) (CHEBI:77804) |
| Incoming Relation(s) |
| biochanin A 7-O-β-D-glucoside(1−) (CHEBI:77804) is conjugate base of biochanin A 7-O-β-D-glucoside (CHEBI:28751) |
| IUPAC Name |
|---|
| 5-hydroxy-3-(4-methoxyphenyl)-4-oxo-4H-chromen-7-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Biochanin A-beta-D-glucoside | KEGG COMPOUND |
| biochanin A 7-O-β-D-glucoside | IUBMB |
| sissotrin | HMDB |
| Sissotrin | KEGG COMPOUND |
| Biochanin A 7-O-beta-D-glucoside | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05376 | KEGG COMPOUND |
| C05376 | KEGG COMPOUND |
| HMDB0033990 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1302649 | Reaxys |
| CAS:5928-26-7 | KEGG COMPOUND |
| Citations |
|---|